| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| LGC Standards | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (20) 8943-8480 | |||
![]() |
uksales@lgcstandards.com | |||
| Chemical manufacturer since 2007 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | 4-Chlorobenzylidene Phthalide |
| Synonyms | (3Z)-3-[(4-Chlorophenyl)Methylidene]-2-Benzofuran-1-One; 3-[(4-Chlorophenyl)Methylene]Isobenzofuran-1-One; (3Z)-3-[(4-Chlorophenyl)Methylene]Isobenzofuran-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H9ClO2 |
| Molecular Weight | 256.69 |
| CAS Registry Number | 20526-97-0 |
| EINECS | 243-862-5 |
| SMILES | C1=CC(=CC=C1Cl)\C=C\2OC(=O)C3=C2C=CC=C3 |
| InChI | 1S/C15H9ClO2/c16-11-7-5-10(6-8-11)9-14-12-3-1-2-4-13(12)15(17)18-14/h1-9H/b14-9- |
| InChIKey | OHRFHJYUEWVXBD-ZROIWOOFSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.899°C at 760 mmHg (Cal.) |
| Flash point | 220.393°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Chlorobenzylidene Phthalide |