|
CAS#: 20544-37-0 Product: 3,9-Dibenzyl-2,4,8,10-Tetraoxa-3,9-Diphosphaspiro[5.5]Undecane 3,9-Dioxide No suppilers available for the product. |
| Name | 3,9-Dibenzyl-2,4,8,10-Tetraoxa-3,9-Diphosphaspiro[5.5]Undecane 3,9-Dioxide |
|---|---|
| Synonyms | 3,9-Bis(Benzyl)-2,4,8,10-Tetraoxa-3$L^{5},9$L^{5}-Diphosphaspiro[5.5]Undecane 3,9-Dioxide; 2,4,8,10-Tetraoxa-3,9-Diphosphaspiro(5.5)Undecane, 3,9-Bis(Phenylmethyl)-, 3,9-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22O6P2 |
| Molecular Weight | 408.33 |
| CAS Registry Number | 20544-37-0 |
| EINECS | 243-869-3 |
| SMILES | C1=CC=C(C=C1)C[P]4(=O)OCC3(CO[P](=O)(CC2=CC=CC=C2)OC3)CO4 |
| InChI | 1S/C19H22O6P2/c20-26(11-17-7-3-1-4-8-17)22-13-19(14-23-26)15-24-27(21,25-16-19)12-18-9-5-2-6-10-18/h1-10H,11-16H2 |
| InChIKey | XRBKIMPIQSGVAO-UHFFFAOYSA-N |
| Density | 1.347g/cm3 (Cal.) |
|---|---|
| Boiling point | 576.541°C at 760 mmHg (Cal.) |
| Flash point | 315.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,9-Dibenzyl-2,4,8,10-Tetraoxa-3,9-Diphosphaspiro[5.5]Undecane 3,9-Dioxide |