|
CAS#: 20559-05-1 Product: Retinyl Pivalate No suppilers available for the product. |
| Name | Retinyl Pivalate |
|---|---|
| Synonyms | 2,2-Dimethylpropanoic Acid [(2E,4E,6E,8E)-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenyl] Ester; 2,2-Dimethylpropionic Acid [(2E,4E,6E,8E)-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.57 |
| CAS Registry Number | 20559-05-1 |
| EINECS | 243-876-1 |
| SMILES | C(OC(=O)C(C)(C)C)/C=C(/C=C/C=C(/C=C/C1=C(CCCC1(C)C)C)C)C |
| InChI | 1S/C25H38O2/c1-19(14-15-22-21(3)13-10-17-25(22,7)8)11-9-12-20(2)16-18-27-23(26)24(4,5)6/h9,11-12,14-16H,10,13,17-18H2,1-8H3/b12-9+,15-14+,19-11+,20-16+ |
| InChIKey | LTMXTDZZEINTQC-FYBJENTQSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.518°C at 760 mmHg (Cal.) |
| Flash point | 113.25°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Retinyl Pivalate |