|
CAS#: 20633-06-1 Product: 3,3,5,5-Tetramethyl-1,2-Cyclopentanedione No suppilers available for the product. |
| Name | 3,3,5,5-Tetramethyl-1,2-Cyclopentanedione |
|---|---|
| Synonyms | 3,3,5,5-Tetramethylcyclopentane-1,2-Quinone; 3,3,5,5-Tetramethyl-1,2-Cyclopentanedione; 1,2-Cyclopentanedione, 3,3,5,5-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 |
| CAS Registry Number | 20633-06-1 |
| SMILES | CC1(C)C(=O)C(C(C1)(C)C)=O |
| InChI | 1S/C9H14O2/c1-8(2)5-9(3,4)7(11)6(8)10/h5H2,1-4H3 |
| InChIKey | PSTFMALKVLSKOP-UHFFFAOYSA-N |
| Density | 0.973g/cm3 (Cal.) |
|---|---|
| Boiling point | 198.391°C at 760 mmHg (Cal.) |
| Flash point | 69.08°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,5,5-Tetramethyl-1,2-Cyclopentanedione |