|
CAS#: 20651-89-2 Product: 3,3,6,6-Tetramethylcyclohexane-1,2-Dione No suppilers available for the product. |
| Name | 3,3,6,6-Tetramethylcyclohexane-1,2-Dione |
|---|---|
| Synonyms | 3,3,6,6-Tetramethylcyclohexane-1,2-Quinone; 1,2-Cyclohexanedione, 3,3,6,6-Tetramethyl-; Nsc139165 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 |
| CAS Registry Number | 20651-89-2 |
| SMILES | CC1(C)C(=O)C(C(C)(C)CC1)=O |
| InChI | 1S/C10H16O2/c1-9(2)5-6-10(3,4)8(12)7(9)11/h5-6H2,1-4H3 |
| InChIKey | DTLUXZSCFRVBER-UHFFFAOYSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 221.074°C at 760 mmHg (Cal.) |
| Flash point | 80.296°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,6,6-Tetramethylcyclohexane-1,2-Dione |