| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | N,N-Bis(2-Chloroethyl)Benzene-1,4-Diamine |
|---|---|
| Synonyms | (4-Aminophenyl)-Bis(2-Chloroethyl)Amine; P-Aminophenyl Derivative Of Nitrogen Mustard; P-Phenylenediamine, N,N-Bis(2-Chloroethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 |
| CAS Registry Number | 2067-58-5 |
| SMILES | C1=C(N(CCCl)CCCl)C=CC(=C1)N |
| InChI | 1S/C10H14Cl2N2/c11-5-7-14(8-6-12)10-3-1-9(13)2-4-10/h1-4H,5-8,13H2 |
| InChIKey | HWAVIYAFGOQVNJ-UHFFFAOYSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.802°C at 760 mmHg (Cal.) |
| Flash point | 175.031°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(2-Chloroethyl)Benzene-1,4-Diamine |