Online Database of Chemicals from Around the World
|
CAS#: 20690-84-0 Product: 4-[4-Hydroxy-3,5-Bis(2-Methyl-2-Propanyl)Benzyl]-2,6-Dimethylphenol No suppilers available for the product. |
| Name | 4-[4-Hydroxy-3,5-Bis(2-Methyl-2-Propanyl)Benzyl]-2,6-Dimethylphenol |
|---|---|
| Synonyms | Mesitol, α4-(3,5-di-tert-butyl-4-hydroxyphenyl)- |
| Molecular Structure | ![CAS#: 20690-84-0, 4-[4-Hydroxy-3,5-Bis(2-Methyl-2-Propanyl)Benzyl]-2,6-Dimethylphenol](/moreStructures/20690-84-0.gif) |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.50 |
| CAS Registry Number | 20690-84-0 |
| SMILES | Oc1c(cc(cc1C(C)(C)C)Cc2cc(c(O)c(c2)C)C)C(C)(C)C |
| InChI | 1S/C23H32O2/c1-14-9-16(10-15(2)20(14)24)11-17-12-18(22(3,4)5)21(25)19(13-17)23(6,7)8/h9-10,12-13,24-25H,11H2,1-8H3 |
| InChIKey | NHXXTZWEQOFSGU-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.384°C at 760 mmHg (Cal.) |
| Flash point | 181.108°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[4-Hydroxy-3,5-Bis(2-Methyl-2-Propanyl)Benzyl]-2,6-Dimethylphenol |