|
CAS#: 20711-00-6 Product: Cyclocystine No suppilers available for the product. |
| Name | Cyclocystine |
|---|---|
| Synonyms | (4R)-7-Amino-6-Keto-1,2,5-Dithiazocane-4-Carboxylic Acid; 3,4-Dithia-7,9-Diazabicyclo(4.2.2)Decane-8,10-Dione; Cyclocystine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10N2O3S2 |
| Molecular Weight | 222.28 |
| CAS Registry Number | 20711-00-6 |
| SMILES | [C@H]1(CSSCC(C(N1)=O)N)C(=O)O |
| InChI | 1S/C6H10N2O3S2/c7-3-1-12-13-2-4(6(10)11)8-5(3)9/h3-4H,1-2,7H2,(H,8,9)(H,10,11)/t3?,4-/m0/s1 |
| InChIKey | NLBLLPROASDPSC-BKLSDQPFSA-N |
| Density | 1.451g/cm3 (Cal.) |
|---|---|
| Boiling point | 567.888°C at 760 mmHg (Cal.) |
| Flash point | 297.248°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclocystine |