|
CAS#: 20716-25-0 Product: 3-(4-Nitrophenyl)-1-Propanol No suppilers available for the product. |
| Name | 3-(4-Nitrophenyl)-1-Propanol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 20716-25-0 |
| SMILES | C1=CC(=CC=C1CCCO)[N+](=O)[O-] |
| InChI | 1S/C9H11NO3/c11-7-1-2-8-3-5-9(6-4-8)10(12)13/h3-6,11H,1-2,7H2 |
| InChIKey | VSMANSLTTPNSMB-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.4±17.0°C at 760 mmHg (Cal.) |
| Flash point | 151.9±9.4°C (Cal.) |
| Refractive index | 1.569 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Nitrophenyl)-1-Propanol |