| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 3-[(2-Hydroxyethyl)Sulfanyl]-6,6-Dimethyl-1-(1,3-Thiazol-2-Yl)-6,7-Dihydro-2-Benzothiophen-4(5H)-One |
|---|---|
| Synonyms | [207306-50-1]; 3-(2-Hydr |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17NO2S3 |
| Molecular Weight | 339.50 |
| CAS Registry Number | 207306-50-1 |
| SMILES | CC1(CC2=C(SC(=C2C(=O)C1)SCCO)C3=NC=CS3)C |
| InChI | 1S/C15H17NO2S3/c1-15(2)7-9-11(10(18)8-15)14(20-6-4-17)21-12(9)13-16-3-5-19-13/h3,5,17H,4,6-8H2,1-2H3 |
| InChIKey | QILRYFCEXLFIDS-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.9±60.0°C at 760 mmHg (Cal.) |
| Flash point | 283.3±32.9°C (Cal.) |
| Refractive index | 1.665 (Cal.) |
| solubility | Soluble to 100 mM in DMSO and to 25 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for 3-[(2-Hydroxyethyl)Sulfanyl]-6,6-Dimethyl-1-(1,3-Thiazol-2-Yl)-6,7-Dihydro-2-Benzothiophen-4(5H)-One |