|
CAS#: 20772-50-3 Product: Isopropyl L-methioninate (2E)-2-butenedioate (2:1) No suppilers available for the product. |
| Name | Isopropyl L-methioninate (2E)-2-butenedioate (2:1) |
|---|---|
| Synonyms | bis[O-isopropyl-DL-methionine] fumarate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H38N2O8S2 |
| Molecular Weight | 498.65 |
| CAS Registry Number | 20772-50-3 |
| EINECS | 244-022-0 |
| SMILES | O=C(OC(C)C)[C@@H](N)CCSC.OC(=O)/C=C/C(O)=O.CC(C)OC(=O)[C@@H](N)CCSC |
| InChI | 1S/2C8H17NO2S.C4H4O4/c2*1-6(2)11-8(10)7(9)4-5-12-3;5-3(6)1-2-4(7)8/h2*6-7H,4-5,9H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*7-;/m00./s1 |
| InChIKey | HJPAWJBAADASMW-NSSXTIIFSA-N |
| Boiling point | 660.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 353.2°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl L-methioninate (2E)-2-butenedioate (2:1) |