|
CAS#: 2078-42-4 Product: Sodium 2,3,6-Trichlorobenzoate No suppilers available for the product. |
| Name | Sodium 2,3,6-Trichlorobenzoate |
|---|---|
| Synonyms | 2,3,6-Tba-Sodium; 2,3,6-Trichlorobenzoic Acid, Sodium Salt; Benzoic Acid, 2,3,6-Trichloro-, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C7H2Cl3NaO2 |
| Molecular Weight | 247.44 |
| CAS Registry Number | 2078-42-4 |
| EINECS | 218-205-0 |
| SMILES | C1=C(C(=C(C(=C1)Cl)Cl)C([O-])=O)Cl.[Na+] |
| InChI | 1S/C7H3Cl3O2.Na/c8-3-1-2-4(9)6(10)5(3)7(11)12;/h1-2H,(H,11,12);/q;+1/p-1 |
| InChIKey | DPMABEYFRYKAHD-UHFFFAOYSA-M |
| Boiling point | 324.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 150.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,3,6-Trichlorobenzoate |