|
CAS#: 20782-58-5 Product: 3-(3-Chloro-4-Ethoxyphenyl)-1,1-Dimethylurea No suppilers available for the product. |
| Name | 3-(3-Chloro-4-Ethoxyphenyl)-1,1-Dimethylurea |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.70 |
| CAS Registry Number | 20782-58-5 |
| SMILES | Clc1cc(ccc1OCC)NC(=O)N(C)C |
| InChI | 1S/C11H15ClN2O2/c1-4-16-10-6-5-8(7-9(10)12)13-11(15)14(2)3/h5-7H,4H2,1-3H3,(H,13,15) |
| InChIKey | YKYGJHGXTSEGDB-UHFFFAOYSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.056°C at 760 mmHg (Cal.) |
| Flash point | 196.957°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3-Chloro-4-Ethoxyphenyl)-1,1-Dimethylurea |