|
CAS#: 20823-96-5 Product: Adiantifoline No suppilers available for the product. |
| Name | Adiantifoline |
|---|---|
| Synonyms | Adiantifoline; C09323 |
| Molecular Structure | ![]() |
| Molecular Formula | C42H50N2O9 |
| Molecular Weight | 726.87 |
| CAS Registry Number | 20823-96-5 |
| SMILES | [C@H]17C2=C(CCN1C)C(=C(C(=C2C6=CC(=C(OC5=C(C[C@H]4C3=CC(=C(OC)C=C3CCN4C)OC)C=C(C(=C5)OC)OC)C=C6C7)OC)OC)OC)OC |
| InChI | 1S/C42H50N2O9/c1-43-13-11-23-17-32(45-3)34(47-5)20-27(23)29(43)16-25-19-33(46-4)36(49-7)22-31(25)53-37-18-24-15-30-38-26(12-14-44(30)2)40(50-8)42(52-10)41(51-9)39(38)28(24)21-35(37)48-6/h17-22,29-30H,11-16H2,1-10H3/t29-,30-/m0/s1 |
| InChIKey | UEKRHVIBSZVFQN-KYJUHHDHSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 780.763°C at 760 mmHg (Cal.) |
| Flash point | 183.192°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Adiantifoline |