| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | N-[(2R)-1-({[(1R,3S)-3-(Aminomethyl)Cyclohexyl]Methyl}Amino)-3-(1H-Indol-3-Yl)-1-Oxo-2-Propanyl]-1'H-Spiro[Indene-1,4'-Piperidine]-1'-Carboxamide |
|---|---|
| Synonyms | (1R,1'S,3'R/1R,1'R,3'S)-L-054,264; N-[(1R)-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C33H41N5O2 |
| Molecular Weight | 539.71 |
| CAS Registry Number | 208706-12-1 |
| SMILES | C1C[C@@H](C[C@@H](C1)CNC(=O)[C@@H](CC2=CNC3=CC=CC=C32)NC(=O)N4CCC5(CC4)C=CC6=CC=CC=C56)CN |
| InChI | 1S/C33H41N5O2/c34-20-23-6-5-7-24(18-23)21-36-31(39)30(19-26-22-35-29-11-4-2-9-27(26)29)37-32(40)38-16-14-33(15-17-38)13-12-25-8-1-3-10-28(25)33/h1-4,8-13,22-24,30,35H,5-7,14-21,34H2,(H,36,39)(H,37,40)/t23-,24+,30+/m0/s1 |
| InChIKey | DAMXHAMKVXERLM-FVBCXUTKSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 865.2±65.0°C at 760 mmHg (Cal.) |
| Flash point | 477.1±34.3°C (Cal.) |
| Refractive index | 1.668 (Cal.) |
| solubility | Soluble to 50 mM in DMSO and to 100 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for N-[(2R)-1-({[(1R,3S)-3-(Aminomethyl)Cyclohexyl]Methyl}Amino)-3-(1H-Indol-3-Yl)-1-Oxo-2-Propanyl]-1'H-Spiro[Indene-1,4'-Piperidine]-1'-Carboxamide |