|
CAS#: 2093-29-0 Product: 3-(1,3-Dimethylpyrrolidin-3-Yl)Phenol No suppilers available for the product. |
| Name | 3-(1,3-Dimethylpyrrolidin-3-Yl)Phenol |
|---|---|
| Synonyms | 3-(1,3-Dimethyl-3-Pyrrolidinyl)Phenol; 1,3-Dimethyl-3-(M-Hydroxyphenyl)Pyrrolidine; 5-21-02-00389 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 |
| CAS Registry Number | 2093-29-0 |
| SMILES | C2=C(C1(CN(CC1)C)C)C=CC=C2O |
| InChI | 1S/C12H17NO/c1-12(6-7-13(2)9-12)10-4-3-5-11(14)8-10/h3-5,8,14H,6-7,9H2,1-2H3 |
| InChIKey | WNFFIEOSTPUMGJ-UHFFFAOYSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.868°C at 760 mmHg (Cal.) |
| Flash point | 142.691°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1,3-Dimethylpyrrolidin-3-Yl)Phenol |