|
CAS#: 20958-63-8 Product: 3-(1,1-Dimethyl Allyl)Herniarin No suppilers available for the product. |
| Name | 3-(1,1-Dimethyl Allyl)Herniarin |
|---|---|
| Synonyms | 3-(1,1-Dimethylprop-2-Enyl)-7-Methoxy-Chromen-2-One; 3-(1,1-Dimethylprop-2-Enyl)-7-Methoxy-2-Chromenone; 3-(1,1-Dimethylprop-2-Enyl)-7-Methoxy-Coumarin |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 |
| CAS Registry Number | 20958-63-8 |
| SMILES | C2=C1OC(=O)C(=CC1=CC=C2OC)C(C=C)(C)C |
| InChI | 1S/C15H16O3/c1-5-15(2,3)12-8-10-6-7-11(17-4)9-13(10)18-14(12)16/h5-9H,1H2,2-4H3 |
| InChIKey | BTXKAWICQLJRID-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.002°C at 760 mmHg (Cal.) |
| Flash point | 156.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1,1-Dimethyl Allyl)Herniarin |