|
CAS#: 20979-00-4 Product: 3-(4-Ethoxyphenyl)-2H-1,3-Benzoxazin-4(3H)-One No suppilers available for the product. |
| Name | 3-(4-Ethoxyphenyl)-2H-1,3-Benzoxazin-4(3H)-One |
|---|---|
| Synonyms | 3-(P-Ethoxyphenyl)-2,3-Dihydro-4H-1,3-Benzoxazin-4-One; 4H-1,3-Benzoxazin-4-One, 3-(P-Ethoxyphenyl)-2,3-Dihydro-; Brn 1586407 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 |
| CAS Registry Number | 20979-00-4 |
| SMILES | C1=CC=CC3=C1C(=O)N(C2=CC=C(OCC)C=C2)CO3 |
| InChI | 1S/C16H15NO3/c1-2-19-13-9-7-12(8-10-13)17-11-20-15-6-4-3-5-14(15)16(17)18/h3-10H,2,11H2,1H3 |
| InChIKey | JZDNPTVOJHBNIN-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.667°C at 760 mmHg (Cal.) |
| Flash point | 229.984°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Ethoxyphenyl)-2H-1,3-Benzoxazin-4(3H)-One |