|
CAS#: 20982-42-7 Product: 8-Acetyl-1,6,10,11-Tetrahydroxy-5,12-Tetracenedione No suppilers available for the product. |
| Name | 8-Acetyl-1,6,10,11-Tetrahydroxy-5,12-Tetracenedione |
|---|---|
| Synonyms | 8-Acetyl-1,6,10,11-tetrahydroxy-5,12-naphthacenedione # |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12O7 |
| Molecular Weight | 364.31 |
| CAS Registry Number | 20982-42-7 |
| SMILES | CC(=O)c1cc4c(c(O)c1)c(O)c3c(C(=O)c2cccc(O)c2C3=O)c4O |
| InChI | 1S/C20H12O7/c1-7(21)8-5-10-14(12(23)6-8)20(27)16-15(18(10)25)17(24)9-3-2-4-11(22)13(9)19(16)26/h2-6,22-23,25,27H,1H3 |
| InChIKey | LHJSHLRGZPMADG-UHFFFAOYSA-N |
| Density | 1.668g/cm3 (Cal.) |
|---|---|
| Boiling point | 599.302°C at 760 mmHg (Cal.) |
| Flash point | 330.275°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Acetyl-1,6,10,11-Tetrahydroxy-5,12-Tetracenedione |