|
CAS#: 21038-11-9 Product: 3,4-Dihydro-7-Nitro-3-(1-Oxopropyl)-1H-2,3-Benzoxazine No suppilers available for the product. |
| Name | 3,4-Dihydro-7-Nitro-3-(1-Oxopropyl)-1H-2,3-Benzoxazine |
|---|---|
| Synonyms | 1H-2,3-Benzoxazine, 3,4-Dihydro-7-Nitro-3-Propionyl-; 7-Nitro-3-Propionyl-3,4-Dihydro-1H-2,3-Benzoxazine; Brn 1133402 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 |
| CAS Registry Number | 21038-11-9 |
| SMILES | C1=C([N+]([O-])=O)C=CC2=C1CON(C2)C(=O)CC |
| InChI | 1S/C11H12N2O4/c1-2-11(14)12-6-8-3-4-10(13(15)16)5-9(8)7-17-12/h3-5H,2,6-7H2,1H3 |
| InChIKey | PMMVHZSWDJDSQU-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.648°C at 760 mmHg (Cal.) |
| Flash point | 176.752°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-7-Nitro-3-(1-Oxopropyl)-1H-2,3-Benzoxazine |