|
CAS#: 21053-63-4 Product: 4-Methyl-5-Phenyl-2(5H)-Furanone No suppilers available for the product. |
| Name | 4-Methyl-5-Phenyl-2(5H)-Furanone |
|---|---|
| Synonyms | 4-Methyl-5-phenyl-2(5H)-furanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 21053-63-4 |
| SMILES | O=C/2OC(c1ccccc1)C(=C\2)\C |
| InChI | 1S/C11H10O2/c1-8-7-10(12)13-11(8)9-5-3-2-4-6-9/h2-7,11H,1H3 |
| InChIKey | GQFMUQLBWWQUKU-UHFFFAOYSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.41°C at 760 mmHg (Cal.) |
| Flash point | 141.813°C (Cal.) |
| Refractive index | 1.558 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-5-Phenyl-2(5H)-Furanone |