|
CAS#: 2106-41-4 Product: 1,3-Difluoro-2,4-Dinitrobenzene No suppilers available for the product. |
| Name | 1,3-Difluoro-2,4-Dinitrobenzene |
|---|---|
| Synonyms | 1,3-Difluoro-2,4-Dinitro-Benzene; Nsc83551 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2F2N2O4 |
| Molecular Weight | 204.09 |
| CAS Registry Number | 2106-41-4 |
| SMILES | C1=C(C(=C(C(=C1)[N+](=O)[O-])F)[N+](=O)[O-])F |
| InChI | 1S/C6H2F2N2O4/c7-3-1-2-4(9(11)12)5(8)6(3)10(13)14/h1-2H |
| InChIKey | FMVDUSBGCFWYGL-UHFFFAOYSA-N |
| Density | 1.679g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.273°C at 760 mmHg (Cal.) |
| Flash point | 145.077°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3-Difluoro-2,4-Dinitrobenzene |