|
CAS#: 21071-31-8 Product: Tris(2-Hydroxyethyl)Ammonium Phosphate No suppilers available for the product. |
| Name | Tris(2-Hydroxyethyl)Ammonium Phosphate |
|---|---|
| Synonyms | tris(2-hydroxyethyl)ammonium dihydrogen phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16NO7P |
| Molecular Weight | 245.17 |
| CAS Registry Number | 21071-31-8 |
| EINECS | 244-192-6 |
| SMILES | OCC[NH+](CCO)CCO.[O-]P([O-])([O-])=O |
| InChI | 1S/C6H15NO3.H3O4P/c8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-10H,1-6H2;(H3,1,2,3,4)/p-2 |
| InChIKey | NHFDKKSSQWCEES-UHFFFAOYSA-L |
| Boiling point | 590.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 311.2°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(2-Hydroxyethyl)Ammonium Phosphate |