|
CAS#: 210896-25-6 Product: 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-[(4-Methyl-2-Pentanyl)Oxy]Octane No suppilers available for the product. |
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-[(4-Methyl-2-Pentanyl)Oxy]Octane |
|---|---|
| Synonyms | OCTANE, 8 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17F13O |
| Molecular Weight | 448.26 |
| CAS Registry Number | 210896-25-6 |
| SMILES | FC(F)(CCOC(CC(C)C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C14H17F13O/c1-7(2)6-8(3)28-5-4-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h7-8H,4-6H2,1-3H3 |
| InChIKey | REMSMUILZZYKPD-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.754°C at 760 mmHg (Cal.) |
| Flash point | 104.54°C (Cal.) |
| Refractive index | 1.338 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-[(4-Methyl-2-Pentanyl)Oxy]Octane |