|
CAS#: 21115-77-5 Product: 1,5,10-Trimethylcyclododeca-1,5,9-Triene No suppilers available for the product. |
| Name | 1,5,10-Trimethylcyclododeca-1,5,9-Triene |
|---|---|
| Synonyms | 1,5,10-Trimethylcyclododeca-1,5,9-Triene; St5445864; 1,5,9-Cyclododecatriene, 1,5,10-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 21115-77-5 |
| EINECS | 244-218-6 |
| SMILES | C\C1=C\CCC(=C\CC/C=C(CC1)/C)/C |
| InChI | 1S/C15H24/c1-13-7-4-5-8-14(2)11-12-15(3)10-6-9-13/h7-8,10H,4-6,9,11-12H2,1-3H3/b13-7-,14-8-,15-10- |
| InChIKey | DRDYICOUDVAVGE-MSKXPCFJSA-N |
| Density | 0.828g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.286°C at 760 mmHg (Cal.) |
| Flash point | 119.051°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,5,10-Trimethylcyclododeca-1,5,9-Triene |