Online Database of Chemicals from Around the World
|
CAS#: 21133-87-9 Product: 4-Ethyl-2-(4-Fluorophenyl)-2,4-Hexanediol No suppilers available for the product. |
| Name | 4-Ethyl-2-(4-Fluorophenyl)-2,4-Hexanediol |
|---|---|
| Synonyms | P-Fluorophenyl-1-Methyl-1-Diethyl-3,3 Propanediol-1,3; 2,4-Hexanediol, 2-(P-Fluorophenyl)-4-Ethyl-; Brn 2374839 |
| Molecular Structure |  |
| Molecular Formula | C14H21FO2 |
| Molecular Weight | 240.32 |
| CAS Registry Number | 21133-87-9 |
| SMILES | C1=C(C(O)(CC(O)(CC)CC)C)C=CC(=C1)F |
| InChI | 1S/C14H21FO2/c1-4-14(17,5-2)10-13(3,16)11-6-8-12(15)9-7-11/h6-9,16-17H,4-5,10H2,1-3H3 |
| InChIKey | DEKTTZLLHCKGEN-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.138°C at 760 mmHg (Cal.) |
| Flash point | 174.024°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethyl-2-(4-Fluorophenyl)-2,4-Hexanediol |