|
CAS#: 21141-47-9 Product: 2,2-Diphenyl-1-(4-Ethylphenyl)-1-Nitroethene No suppilers available for the product. |
| Name | 2,2-Diphenyl-1-(4-Ethylphenyl)-1-Nitroethene |
|---|---|
| Synonyms | 1-Ethyl-4-[1-Nitro-2,2-Di(Phenyl)Vinyl]Benzene; 2,2-Diphenyl-1-(P-Ethylphenyl)-1-Nitroethylene; Brn 2336186 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 |
| CAS Registry Number | 21141-47-9 |
| SMILES | C3=C(C([N+]([O-])=O)=C(C1=CC=CC=C1)C2=CC=CC=C2)C=CC(=C3)CC |
| InChI | 1S/C22H19NO2/c1-2-17-13-15-20(16-14-17)22(23(24)25)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16H,2H2,1H3 |
| InChIKey | YSNYSJITEWGPRU-UHFFFAOYSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.042°C at 760 mmHg (Cal.) |
| Flash point | 178.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Diphenyl-1-(4-Ethylphenyl)-1-Nitroethene |