|
CAS#: 21170-62-7 Product: 1,1'-(4-Isopropyl-2,6-Dimethyl-1,4-Dihydropyridine-3,5-Diyl)Diethanone No suppilers available for the product. |
| Name | 1,1'-(4-Isopropyl-2,6-Dimethyl-1,4-Dihydropyridine-3,5-Diyl)Diethanone |
|---|---|
| Synonyms | 2,6-Lutidine, 3,5-diacetyl-1,4-dihydro-4-isopropyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.32 |
| CAS Registry Number | 21170-62-7 |
| SMILES | O=C(\C1=C(\N/C(=C(/C(=O)C)C1C(C)C)C)C)C |
| InChI | 1S/C14H21NO2/c1-7(2)12-13(10(5)16)8(3)15-9(4)14(12)11(6)17/h7,12,15H,1-6H3 |
| InChIKey | FLQGYNGSFPJLCS-UHFFFAOYSA-N |
| Density | 0.999g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.477°C at 760 mmHg (Cal.) |
| Flash point | 131.502°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(4-Isopropyl-2,6-Dimethyl-1,4-Dihydropyridine-3,5-Diyl)Diethanone |