|
CAS#: 21201-44-5 Product: 1,4-Dihydroxy-2(1H)-Quinolinone No suppilers available for the product. |
| Name | 1,4-Dihydroxy-2(1H)-Quinolinone |
|---|---|
| Synonyms | 1,4-Dihydroxy-2(1H)-quinolinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 21201-44-5 |
| SMILES | O/C2=C/C(=O)N(O)c1ccccc12 |
| InChI | 1S/C9H7NO3/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,11,13H |
| InChIKey | ZXVQFMZWPCRJKI-UHFFFAOYSA-N |
| Density | 1.624g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.269°C at 760 mmHg (Cal.) |
| Flash point | 181.361°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dihydroxy-2(1H)-Quinolinone |