|
CAS#: 21208-96-8 Product: 2-(2-Cyclohexylpropyl)Aminoethanethiol Sulfate No suppilers available for the product. |
| Name | 2-(2-Cyclohexylpropyl)Aminoethanethiol Sulfate |
|---|---|
| Synonyms | [(2S)-2-Cyclohexylpropyl]-(2-Hydroxysulfonothioyloxyethyl)Amine; S-2-((2-Cyclohexyl-2-Methyl)Ethylamino)Ethyl Thiosulfate; 2-((2-Cyclohexyl-2-Methyl)Ethylamino)Ethanethiol Hydrogen Sulfate (Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H23NO3S2 |
| Molecular Weight | 281.43 |
| CAS Registry Number | 21208-96-8 |
| SMILES | [C@H](CNCCO[S](=O)(O)=S)(C)C1CCCCC1 |
| InChI | 1S/C11H23NO3S2/c1-10(11-5-3-2-4-6-11)9-12-7-8-15-17(13,14)16/h10-12H,2-9H2,1H3,(H,13,14,16)/t10-/m1/s1 |
| InChIKey | GKEXTNQBBRYYAK-SNVBAGLBSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.064°C at 760 mmHg (Cal.) |
| Flash point | 203.614°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Cyclohexylpropyl)Aminoethanethiol Sulfate |