|
CAS#: 21226-94-8 Product: 2-[2-(3-Methylcyclohexyl)Butyl]Aminoethanethiol Sulfate No suppilers available for the product. |
| Name | 2-[2-(3-Methylcyclohexyl)Butyl]Aminoethanethiol Sulfate |
|---|---|
| Synonyms | 2-Hydroxysulfonothioyloxyethyl-[(2S)-2-(3-Methylcyclohexyl)Butyl]Amine; 2-(((2-Ethyl-2-(3-Methylcyclohexyl))Ethyl)Amino)Ethanethiol Hydrogen Sulfate (Ester); Brn 2981695 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H27NO3S2 |
| Molecular Weight | 309.48 |
| CAS Registry Number | 21226-94-8 |
| SMILES | [C@H](C1CC(CCC1)C)(CNCCO[S](=S)(=O)O)CC |
| InChI | 1S/C13H27NO3S2/c1-3-12(13-6-4-5-11(2)9-13)10-14-7-8-17-19(15,16)18/h11-14H,3-10H2,1-2H3,(H,15,16,18)/t11?,12-,13?/m1/s1 |
| InChIKey | YXJSRDFVGFYGHO-OTTFEQOBSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.182°C at 760 mmHg (Cal.) |
| Flash point | 214.571°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-(3-Methylcyclohexyl)Butyl]Aminoethanethiol Sulfate |