|
CAS#: 2123-92-4 Product: Tert-Butyl 3-Phenylprop-2-Eneperoxoate No suppilers available for the product. |
| Name | Tert-Butyl 3-Phenylprop-2-Eneperoxoate |
|---|---|
| Synonyms | Tert-Butyl (E)-3-Phenylprop-2-Eneperoxoate; 3-Phenylprop-2-Eneperoxoic Acid Tert-Butyl Ester; (E)-3-Phenylprop-2-Eneperoxoic Acid Tert-Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 2123-92-4 |
| EINECS | 218-338-4 |
| SMILES | C1=C(/C=C/C(OOC(C)(C)C)=O)C=CC=C1 |
| InChI | 1S/C13H16O3/c1-13(2,3)16-15-12(14)10-9-11-7-5-4-6-8-11/h4-10H,1-3H3/b10-9+ |
| InChIKey | BPCBXWVRESTYBG-MDZDMXLPSA-N |
| Density | 1.068g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.106°C at 760 mmHg (Cal.) |
| Flash point | 102.434°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl 3-Phenylprop-2-Eneperoxoate |