|
CAS#: 2126-63-8 Product: 3-(6-Chloro-3-Methyl-1H-Inden-2-Yl)Pyridine No suppilers available for the product. |
| Name | 3-(6-Chloro-3-Methyl-1H-Inden-2-Yl)Pyridine |
|---|---|
| Synonyms | 3-(6-Chloro-3-Methyl-2-Indenyl)Pyridine; Pyridine, 3-(6-Chloro-3-Methyl-1H-Inden-2-Yl)- (9Ci); Pyridine, 3-(6-Chloro-3-Methylinden-2-Yl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12ClN |
| Molecular Weight | 241.72 |
| CAS Registry Number | 2126-63-8 |
| SMILES | C1=C(Cl)C=CC2=C1CC(=C2C)C3=CC=CN=C3 |
| InChI | 1S/C15H12ClN/c1-10-14-5-4-13(16)7-12(14)8-15(10)11-3-2-6-17-9-11/h2-7,9H,8H2,1H3 |
| InChIKey | STLUNQZEUDXBQE-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.329°C at 760 mmHg (Cal.) |
| Flash point | 201.144°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(6-Chloro-3-Methyl-1H-Inden-2-Yl)Pyridine |