|
CAS#: 21275-19-4 Product: 4-Dimethylamino-1-Phenyl-1H-Pyrazole-5-Methanol No suppilers available for the product. |
| Name | 4-Dimethylamino-1-Phenyl-1H-Pyrazole-5-Methanol |
|---|---|
| Synonyms | (4-Dimethylamino-2-Phenyl-Pyrazol-3-Yl)Methanol; (4-Dimethylamino-2-Phenyl-3-Pyrazolyl)Methanol; 5-25-12-00396 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 |
| CAS Registry Number | 21275-19-4 |
| SMILES | C1=N[N](C(=C1N(C)C)CO)C2=CC=CC=C2 |
| InChI | 1S/C12H15N3O/c1-14(2)11-8-13-15(12(11)9-16)10-6-4-3-5-7-10/h3-8,16H,9H2,1-2H3 |
| InChIKey | FVXOLLKYQMDTGP-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.743°C at 760 mmHg (Cal.) |
| Flash point | 185.277°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Dimethylamino-1-Phenyl-1H-Pyrazole-5-Methanol |