Online Database of Chemicals from Around the World
|
CAS#: 213-44-5 Product: Dibenzo[B,N]Picene No suppilers available for the product. |
| Name | Dibenzo[B,N]Picene |
|---|---|
| Synonyms | Dibenzo(B,N)Picene |
| Molecular Structure | ![CAS#: 213-44-5, Dibenzo[B,N]Picene](/moreStructures/213-44-5.gif) |
| Molecular Formula | C30H18 |
| Molecular Weight | 378.47 |
| CAS Registry Number | 213-44-5 |
| SMILES | C1=C2C(=CC=C1)C=C3C(=C2)C=CC4=C3C=CC5=C4C=CC6=C5C=C7C(=C6)C=CC=C7 |
| InChI | 1S/C30H18/c1-3-7-21-17-29-23(15-19(21)5-1)9-11-25-26-12-10-24-16-20-6-2-4-8-22(20)18-30(24)28(26)14-13-27(25)29/h1-18H |
| InChIKey | IPXVTAOMMAREJT-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 677.037°C at 760 mmHg (Cal.) |
| Flash point | 360.608°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo[B,N]Picene |