|
CAS#: 2130-17-8 Product: Tetrahymanol No suppilers available for the product. |
| Name | Tetrahymanol |
|---|---|
| Synonyms | Gammaceran-3-Ol, (3Beta)-; Lmpr01060010; Chebi:9493 |
| Molecular Structure | ![]() |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.74 |
| CAS Registry Number | 2130-17-8 |
| SMILES | [C@@]35([C@]2([C@@H]([C@]1(CCCC([C@@H]1CC2)(C)C)C)CC[C@@H]3[C@]4(CC[C@@H](C([C@@H]4CC5)(C)C)O)C)C)C |
| InChI | 1S/C30H52O/c1-25(2)15-9-16-27(5)20(25)12-18-29(7)22(27)10-11-23-28(6)17-14-24(31)26(3,4)21(28)13-19-30(23,29)8/h20-24,31H,9-19H2,1-8H3/t20-,21-,22+,23+,24-,27-,28-,29+,30+/m0/s1 |
| InChIKey | BFNSRKHIVITRJP-VJBYBJRLSA-N |
| Density | 0.959g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.42°C at 760 mmHg (Cal.) |
| Flash point | 199.617°C (Cal.) |
| (1) | Abe Ikuro. Enzymatic synthesis of cyclic triterpenes, Natural Product Reports, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tetrahymanol |