| Name | 1-Phenyluracil |
|---|---|
| Synonyms | 1-Phenylpyrimidine-2,4-Quinone; 1-Phenyluracil; 2,4(1H,3H)-Pyrimidinedione, 1-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 |
| CAS Registry Number | 21321-07-3 |
| SMILES | C2=C(N1C(=O)NC(=O)C=C1)C=CC=C2 |
| InChI | 1S/C10H8N2O2/c13-9-6-7-12(10(14)11-9)8-4-2-1-3-5-8/h1-7H,(H,11,13,14) |
| InChIKey | KELXKKNILLDRLS-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| (1) | Tsuyoshi Murata, Suguru Maki, Makoto Ohmoto, Eigo Miyazaki, Yoshikazu Umemoto, Kazuhiro Nakasuji and Yasushi Morita. Redox-active tubular frameworks with TTF: self-assemblies by complementary hydrogen-bonds and π-stacks of TTF-phenyluracil, CrystEngComm, 2011, 13, 6880. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Phenyluracil |