Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,2,2-Trichloro-Aceticacid Calcium Salt (2:1) |
|---|---|
| Synonyms | Calcium 2,2,2-Trichloroethanoate; Calcium Trichloroacetate |
| Molecular Structure |  |
| Molecular Formula | C4CaCl6O4 |
| Molecular Weight | 364.84 |
| CAS Registry Number | 21348-16-3 |
| EINECS | 244-339-4 |
| SMILES | O=C([O-])C(Cl)(Cl)Cl.O=C([O-])C(Cl)(Cl)Cl.[Ca++] |
| InChI | 1S/2C2HCl3O2.Ca/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2 |
| InChIKey | PAFYVDNYOJAWDX-UHFFFAOYSA-L |
| Boiling point | 196.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 66.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trichloro-Aceticacid Calcium Salt (2:1) |