|
CAS#: 2135-57-1 Product: 10-Hydroperoxy-Estr-4-ene-3,17-dione No suppilers available for the product. |
| Name | 10-Hydroperoxy-Estr-4-ene-3,17-dione |
|---|---|
| Synonyms | (8S,9S,13S,14S)-10-Hydroperoxy-13-Methyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,17-Quinone; 10-Hydroperoxy-4-Estrene-3,17-Dione; 10Beta-Hydroperoxy-4-Estrene-3,17-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 |
| CAS Registry Number | 2135-57-1 |
| SMILES | [C@@H]23CCC1=CC(CCC1([C@H]2CC[C@]4([C@H]3CCC4=O)C)OO)=O |
| InChI | 1S/C18H24O4/c1-17-8-7-15-13(14(17)4-5-16(17)20)3-2-11-10-12(19)6-9-18(11,15)22-21/h10,13-15,21H,2-9H2,1H3/t13-,14-,15-,17-,18?/m0/s1 |
| InChIKey | MUNAAPIKEXKOFD-FVJHYMBVSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.151°C at 760 mmHg (Cal.) |
| Flash point | 183.221°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Hydroperoxy-Estr-4-ene-3,17-dione |