|
CAS#: 21383-80-2 Product: 1,5-Diaziridin-1-Ylpentane-1,5-Dione No suppilers available for the product. |
| Name | 1,5-Diaziridin-1-Ylpentane-1,5-Dione |
|---|---|
| Synonyms | 1,5-Bis(1-Aziridinyl)Pentane-1,5-Dione; 1,5-Diethyleniminopentane-1,5-Dione; Nsc44305 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 21383-80-2 |
| SMILES | C(C(N1CC1)=O)CCC(=O)N2CC2 |
| InChI | 1S/C9H14N2O2/c12-8(10-4-5-10)2-1-3-9(13)11-6-7-11/h1-7H2 |
| InChIKey | YEHHXQNOPAZGOL-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.03°C at 760 mmHg (Cal.) |
| Flash point | 208.167°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Diaziridin-1-Ylpentane-1,5-Dione |