|
CAS#: 21390-86-3 Product: 2,3-Dichloro-4-(3-Chloro-2-Nitrophenyl)-1H-Pyrrole No suppilers available for the product. |
| Name | 2,3-Dichloro-4-(3-Chloro-2-Nitrophenyl)-1H-Pyrrole |
|---|---|
| Synonyms | AIDS136155; AIDS-136155 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5Cl3N2O2 |
| Molecular Weight | 291.52 |
| CAS Registry Number | 21390-86-3 |
| SMILES | Clc2c(c1c([N+]([O-])=O)c(Cl)ccc1)cnc2Cl |
| InChI | 1S/C10H5Cl3N2O2/c11-7-3-1-2-5(9(7)15(16)17)6-4-14-10(13)8(6)12/h1-4,14H |
| InChIKey | CZHPYSUGJMFCTC-UHFFFAOYSA-N |
| Density | 1.613g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.206°C at 760 mmHg (Cal.) |
| Flash point | 220.029°C (Cal.) |
| Refractive index | 1.657 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dichloro-4-(3-Chloro-2-Nitrophenyl)-1H-Pyrrole |