|
CAS#: 21404-64-8 Product: 1-Benzyl-3,5,7-Trimethyl-2,4,6,8,9,10-Hexathiatricyclo[3.3.1.13,7]Decane No suppilers available for the product. |
| Name | 1-Benzyl-3,5,7-Trimethyl-2,4,6,8,9,10-Hexathiatricyclo[3.3.1.13,7]Decane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H16S6 |
| Molecular Weight | 376.67 |
| CAS Registry Number | 21404-64-8 |
| SMILES | S1C4(SC2(SC(SC1(S2)Cc3ccccc3)(S4)C)C)C |
| InChI | 1S/C14H16S6/c1-11-15-12(2)17-13(3,16-11)20-14(18-11,19-12)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | ISCISHPWLKFKKZ-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.19°C at 760 mmHg (Cal.) |
| Flash point | 221.827°C (Cal.) |
| Refractive index | 1.78 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-3,5,7-Trimethyl-2,4,6,8,9,10-Hexathiatricyclo[3.3.1.13,7]Decane |