|
CAS#: 21405-81-2 Product: [3-[(2-Hydroxybenzylidene)Amino][1,1'-Biphenyl]-4-Olato(2-)-N,O,O']Copper No suppilers available for the product. |
| Name | [3-[(2-Hydroxybenzylidene)Amino][1,1'-Biphenyl]-4-Olato(2-)-N,O,O']Copper |
|---|---|
| Synonyms | Copper 2-[(2-Oxidophenyl)Methyleneamino]-4-Phenyl-Phenolate; Copper 2-[(2-Oxidophenyl)Methyleneamino]-4-Phenylphenolate; Cupric 2-[(2-Oxidobenzylidene)Amino]-4-Phenyl-Phenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H13CuNO2 |
| Molecular Weight | 350.86 |
| CAS Registry Number | 21405-81-2 |
| EINECS | 244-372-4 |
| SMILES | C2=C(N=CC1=C([O-])C=CC=C1)C(=CC=C2C3=CC=CC=C3)[O-].[Cu++] |
| InChI | 1S/C19H15NO2.Cu/c21-18-9-5-4-8-16(18)13-20-17-12-15(10-11-19(17)22)14-6-2-1-3-7-14;/h1-13,21-22H;/q;+2/p-2 |
| InChIKey | VNGVZRSSWOSMQI-UHFFFAOYSA-L |
| Boiling point | 529.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 355.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3-[(2-Hydroxybenzylidene)Amino][1,1'-Biphenyl]-4-Olato(2-)-N,O,O']Copper |