|
CAS#: 21424-93-1 Product: N-Bromoacetyl-5-Methoxytryptamine No suppilers available for the product. |
| Name | N-Bromoacetyl-5-Methoxytryptamine |
|---|---|
| Synonyms | 2-Bromo-N-[2-(5-Methoxy-1H-Indol-3-Yl)Ethyl]Ethanamide; N-B5m; N-Bromoacetyl-5-Methoxytryptamine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 |
| CAS Registry Number | 21424-93-1 |
| SMILES | C1=C(OC)C=CC2=C1C(=C[NH]2)CCNC(=O)CBr |
| InChI | 1S/C13H15BrN2O2/c1-18-10-2-3-12-11(6-10)9(8-16-12)4-5-15-13(17)7-14/h2-3,6,8,16H,4-5,7H2,1H3,(H,15,17) |
| InChIKey | LUYYGOMIZZLVSS-UHFFFAOYSA-N |
| Density | 1.476g/cm3 (Cal.) |
|---|---|
| Boiling point | 548.699°C at 760 mmHg (Cal.) |
| Flash point | 285.643°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Bromoacetyl-5-Methoxytryptamine |