|
CAS#: 214330-29-7 Product: 1-(1,1-Diethoxyethyl)-2,4-Dimethylbenzene No suppilers available for the product. |
| Name | 1-(1,1-Diethoxyethyl)-2,4-Dimethylbenzene |
|---|---|
| Synonyms | BENZENE,1-(1,1-DIETHOXYETHYL)-2,4-DIMETHYL- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.32 |
| CAS Registry Number | 214330-29-7 |
| SMILES | O(CC)C(OCC)(c1ccc(cc1C)C)C |
| InChI | 1S/C14H22O2/c1-6-15-14(5,16-7-2)13-9-8-11(3)10-12(13)4/h8-10H,6-7H2,1-5H3 |
| InChIKey | PGCBQOYNRABNCJ-UHFFFAOYSA-N |
| Density | 0.948g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.953°C at 760 mmHg (Cal.) |
| Flash point | 86.341°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,1-Diethoxyethyl)-2,4-Dimethylbenzene |