|
CAS#: 21447-45-0 Product: N,N-Bis(2-Chloroethyl)-5-Nitro-2-Methylaniline No suppilers available for the product. |
| Name | N,N-Bis(2-Chloroethyl)-5-Nitro-2-Methylaniline |
|---|---|
| Synonyms | N,N-Bis(2-Chloroethyl)-2-Methyl-5-Nitro-Aniline; Bis(2-Chloroethyl)-(2-Methyl-5-Nitro-Phenyl)Amine; 4-12-00-01808 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 |
| CAS Registry Number | 21447-45-0 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1N(CCCl)CCCl)C |
| InChI | 1S/C11H14Cl2N2O2/c1-9-2-3-10(15(16)17)8-11(9)14(6-4-12)7-5-13/h2-3,8H,4-7H2,1H3 |
| InChIKey | ZWPNVVQXUQWXEY-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.304°C at 760 mmHg (Cal.) |
| Flash point | 197.106°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(2-Chloroethyl)-5-Nitro-2-Methylaniline |