|
CAS#: 21462-48-6 Product: 4-Chlorophenylmercapturic Acid No suppilers available for the product. |
| Name | 4-Chlorophenylmercapturic Acid |
|---|---|
| Synonyms | (2R)-2-Acetamido-3-(4-Chlorophenyl)Sulfanyl-Propanoic Acid; (2R)-2-Acetamido-3-[(4-Chlorophenyl)Thio]Propanoic Acid; (2R)-2-Acetamido-3-[(4-Chlorophenyl)Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.73 |
| CAS Registry Number | 21462-48-6 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CSC1=CC=C(C=C1)Cl |
| InChI | 1S/C11H12ClNO3S/c1-7(14)13-10(11(15)16)6-17-9-4-2-8(12)3-5-9/h2-5,10H,6H2,1H3,(H,13,14)(H,15,16)/t10-/m0/s1 |
| InChIKey | NYIHHVVSWNGRAJ-JTQLQIEISA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.964°C at 760 mmHg (Cal.) |
| Flash point | 268.87°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chlorophenylmercapturic Acid |