|
CAS#: 21462-92-0 Product: 2-Methyl-4-[(4-Methylphenyl)Hydrazono]-2,5-Cyclohexadien-1-One No suppilers available for the product. |
| Name | 2-Methyl-4-[(4-Methylphenyl)Hydrazono]-2,5-Cyclohexadien-1-One |
|---|---|
| Synonyms | NSC83597 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.27 |
| CAS Registry Number | 21462-92-0 |
| SMILES | O=C/2/C=C\C(=NNc1ccc(cc1)C)\C=C\2C |
| InChI | 1S/C14H14N2O/c1-10-3-5-12(6-4-10)15-16-13-7-8-14(17)11(2)9-13/h3-9,15H,1-2H3 |
| InChIKey | NQMNIENDNBKXGC-UHFFFAOYSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.987°C at 760 mmHg (Cal.) |
| Flash point | 167.281°C (Cal.) |
| Refractive index | 1.58 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-[(4-Methylphenyl)Hydrazono]-2,5-Cyclohexadien-1-One |