|
CAS#: 2150-24-5 Product: Propan-2-Yl N-(2,3-Dichlorophenyl)Carbamate No suppilers available for the product. |
| Name | Propan-2-Yl N-(2,3-Dichlorophenyl)Carbamate |
|---|---|
| Synonyms | Isopropyl N-(2,3-Dichlorophenyl)Carbamate; N-(2,3-Dichlorophenyl)Carbamic Acid Isopropyl Ester; Nsc57704 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 |
| CAS Registry Number | 2150-24-5 |
| SMILES | C1=C(C(=C(C=C1)Cl)Cl)NC(OC(C)C)=O |
| InChI | 1S/C10H11Cl2NO2/c1-6(2)15-10(14)13-8-5-3-4-7(11)9(8)12/h3-6H,1-2H3,(H,13,14) |
| InChIKey | UXEAHIFQYGDANS-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.393°C at 760 mmHg (Cal.) |
| Flash point | 121.563°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Propan-2-Yl N-(2,3-Dichlorophenyl)Carbamate |