Online Database of Chemicals from Around the World
|
CAS#: 2151-16-8 Product: Methyl 2-(3,5-Dichloro-2,6-Dihydroxy-4-Methylbenzoyl)-5-Hydroxy-3-Methoxybenzoate No suppilers available for the product. |
| Name | Methyl 2-(3,5-Dichloro-2,6-Dihydroxy-4-Methylbenzoyl)-5-Hydroxy-3-Methoxybenzoate |
|---|---|
| Synonyms | Dihydrogeodin; Geodin, dihydro- |
| Molecular Structure |  |
| Molecular Formula | C17H14Cl2O7 |
| Molecular Weight | 401.19 |
| CAS Registry Number | 2151-16-8 |
| SMILES | CC1=C(C(=C(C(=C1Cl)O)C(=O)C2=C(C=C(C=C2OC)O)C(=O)OC)O)Cl |
| InChI | 1S/C17H14Cl2O7/c1-6-12(18)15(22)11(16(23)13(6)19)14(21)10-8(17(24)26-3)4-7(20)5-9(10)25-2/h4-5,20,22-23H,1-3H3 |
| InChIKey | AXIPUIQLQUNOCF-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.3±55.0°C at 760 mmHg (Cal.) |
| Flash point | 319.9±31.5°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-(3,5-Dichloro-2,6-Dihydroxy-4-Methylbenzoyl)-5-Hydroxy-3-Methoxybenzoate |